C17H27ClN2O2Si — CID 174021379
2-trimethylsilylethyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate (PubChem CID 174021379) has the molecular formula C17H27ClN2O2Si and a molecular weight of 354.95 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate.
| Compound Name | 2-trimethylsilylethyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
|---|---|
| PubChem CID | 174021379 |
| Molecular Formula | C17H27ClN2O2Si |
| Molecular Weight | 354.95 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-trimethylsilylethyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCC[Si](C)(C)C)cc1Cl |
| InChI | InChI=1S/C17H27ClN2O2Si/c1-7-20(3)12-19-16-10-13(2)14(11-15(16)18)17(21)22-8-9-23(4,5)6/h10-12H,7-9H2,1-6H3/b19-12+ |
| InChIKey | HOPNRCBGEDSOFB-XDHOZWIPSA-N |
| XLogP | 4.75 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|