C18H23BrF4N2O2 — CID 155325300
(5-bromo-4,4,5,5-tetrafluoropentyl) 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate (PubChem CID 155325300) has the molecular formula C18H23BrF4N2O2 and a molecular weight of 455.29 g/mol. Its IUPAC name is (5-bromo-4,4,5,5-tetrafluoropentyl) 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate.
| Compound Name | (5-bromo-4,4,5,5-tetrafluoropentyl) 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 155325300 |
| Molecular Formula | C18H23BrF4N2O2 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (5-bromo-4,4,5,5-tetrafluoropentyl) 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCCCC(F)(F)C(F)(F)Br)cc1C |
| InChI | InChI=1S/C18H23BrF4N2O2/c1-5-25(4)11-24-15-10-12(2)14(9-13(15)3)16(26)27-8-6-7-17(20,21)18(19,22)23/h9-11H,5-8H2,1-4H3/b24-11+ |
| InChIKey | RBTOFSPHAMCSDD-BHGWPJFGSA-N |
| XLogP | 5.47 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|