C23H26F2N2O7 — CID 172580439
[4-(difluoromethoxy)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate;oxalic acid (PubChem CID 172580439) has the molecular formula C23H26F2N2O7 and a molecular weight of 480.46 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate;oxalic acid.
| Compound Name | [4-(difluoromethoxy)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate;oxalic acid |
|---|---|
| PubChem CID | 172580439 |
| Molecular Formula | C23H26F2N2O7 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate;oxalic acid |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCc2ccc(OC(F)F)cc2)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H24F2N2O3.C2H2O4/c1-5-25(4)13-24-19-11-14(2)18(10-15(19)3)20(26)27-12-16-6-8-17(9-7-16)28-21(22)23;3-1(4)2(5)6/h6-11,13,21H,5,12H2,1-4H3;(H,3,4)(H,5,6)/b24-13+; |
| InChIKey | WCRDSCYKQKLKBD-KEJAMGHHSA-N |
| XLogP | 4.03 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|