C19H23F2N3O — CID 142322836
N'-[4-[3-(difluoromethoxy)anilino]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 142322836) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is N'-[4-[3-(difluoromethoxy)anilino]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[3-(difluoromethoxy)anilino]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 142322836 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N'-[4-[3-(difluoromethoxy)anilino]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Nc2cccc(OC(F)F)c2)cc1C |
| InChI | InChI=1S/C19H23F2N3O/c1-5-24(4)12-22-17-9-14(3)18(10-13(17)2)23-15-7-6-8-16(11-15)25-19(20)21/h6-12,19,23H,5H2,1-4H3/b22-12+ |
| InChIKey | UOSOWZSRAWCPNU-WSDLNYQXSA-N |
| XLogP | 5.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|