C20H25ClN4 — CID 154017909
N'-[2-chloro-5-methyl-4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154017909) has the molecular formula C20H25ClN4 and a molecular weight of 356.90 g/mol. Its IUPAC name is N'-[2-chloro-5-methyl-4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-5-methyl-4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154017909 |
| Molecular Formula | C20H25ClN4 |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N'-[2-chloro-5-methyl-4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Nc2ccc3c(c2)CCN3C)cc1Cl |
| InChI | InChI=1S/C20H25ClN4/c1-5-24(3)13-22-19-10-14(2)18(12-17(19)21)23-16-6-7-20-15(11-16)8-9-25(20)4/h6-7,10-13,23H,5,8-9H2,1-4H3/b22-13+ |
| InChIKey | OEYZMXLZLNRHIJ-LPYMAVHISA-N |
| XLogP | 5.00 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|