C17H18ClFN2S — CID 162391810
N'-[2-chloro-4-(2-fluorophenyl)sulfanyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 162391810) has the molecular formula C17H18ClFN2S and a molecular weight of 336.86 g/mol. Its IUPAC name is N'-[2-chloro-4-(2-fluorophenyl)sulfanyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-(2-fluorophenyl)sulfanyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 162391810 |
| Molecular Formula | C17H18ClFN2S |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N'-[2-chloro-4-(2-fluorophenyl)sulfanyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Sc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C17H18ClFN2S/c1-4-21(3)11-20-15-9-12(2)17(10-13(15)18)22-16-8-6-5-7-14(16)19/h5-11H,4H2,1-3H3/b20-11+ |
| InChIKey | OUYXLXOCSKVJPK-RGVLZGJSSA-N |
| XLogP | 5.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|