C20H25FN4 — CID 91496481
N-ethyl-N'-[4-[1-[(2-fluorophenyl)diazenyl]ethyl]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 91496481) has the molecular formula C20H25FN4 and a molecular weight of 340.45 g/mol. Its IUPAC name is N-ethyl-N'-[4-[1-[(2-fluorophenyl)diazenyl]ethyl]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[1-[(2-fluorophenyl)diazenyl]ethyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 91496481 |
| Molecular Formula | C20H25FN4 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-ethyl-N'-[4-[1-[(2-fluorophenyl)diazenyl]ethyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(C)/N=N/c2ccccc2F)cc1C |
| InChI | InChI=1S/C20H25FN4/c1-6-25(5)13-22-20-12-14(2)17(11-15(20)3)16(4)23-24-19-10-8-7-9-18(19)21/h7-13,16H,6H2,1-5H3/b22-13+,24-23+ |
| InChIKey | PSNXGMUDPJQJNU-QTANEOQUSA-N |
| XLogP | 5.90 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|