C20H23FN2 — CID 66790824
N-ethyl-N'-[4-[(Z)-2-(2-fluorophenyl)ethenyl]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 66790824) has the molecular formula C20H23FN2 and a molecular weight of 310.42 g/mol. Its IUPAC name is N-ethyl-N'-[4-[(Z)-2-(2-fluorophenyl)ethenyl]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[(Z)-2-(2-fluorophenyl)ethenyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 66790824 |
| Molecular Formula | C20H23FN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-ethyl-N'-[4-[(Z)-2-(2-fluorophenyl)ethenyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(/C=C\c2ccccc2F)cc1C |
| InChI | InChI=1S/C20H23FN2/c1-5-23(4)14-22-20-13-15(2)18(12-16(20)3)11-10-17-8-6-7-9-19(17)21/h6-14H,5H2,1-4H3/b11-10-,22-14+ |
| InChIKey | UMKPUVZVTJWUTG-WLQNZTNDSA-N |
| XLogP | 5.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|