C20H23N3S — CID 162391878
N'-[4-(2-cyanophenyl)sulfanyl-2-ethyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 162391878) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is N'-[4-(2-cyanophenyl)sulfanyl-2-ethyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(2-cyanophenyl)sulfanyl-2-ethyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 162391878 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N'-[4-(2-cyanophenyl)sulfanyl-2-ethyl-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCc1cc(Sc2ccccc2C#N)c(C)cc1/N=C/N(C)CC |
| InChI | InChI=1S/C20H23N3S/c1-5-16-12-20(24-19-10-8-7-9-17(19)13-21)15(3)11-18(16)22-14-23(4)6-2/h7-12,14H,5-6H2,1-4H3/b22-14+ |
| InChIKey | WTJAXDWUHUTORQ-HYARGMPZSA-N |
| XLogP | 5.19 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|