C18H18BrN3OS — CID 162391860
N'-[5-bromo-4-(2-cyanophenyl)sulfinyl-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 162391860) has the molecular formula C18H18BrN3OS and a molecular weight of 404.33 g/mol. Its IUPAC name is N'-[5-bromo-4-(2-cyanophenyl)sulfinyl-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[5-bromo-4-(2-cyanophenyl)sulfinyl-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 162391860 |
| Molecular Formula | C18H18BrN3OS |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N'-[5-bromo-4-(2-cyanophenyl)sulfinyl-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Br)c(S(=O)c2ccccc2C#N)cc1C |
| InChI | InChI=1S/C18H18BrN3OS/c1-4-22(3)12-21-16-10-15(19)18(9-13(16)2)24(23)17-8-6-5-7-14(17)11-20/h5-10,12H,4H2,1-3H3/b21-12+ |
| InChIKey | UGUNKZWYUKNQEF-CIAFOILYSA-N |
| XLogP | 4.41 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|