C19H20FN3 — CID 154647984
N'-[3-[(3-cyanophenyl)methyl]-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154647984) has the molecular formula C19H20FN3 and a molecular weight of 309.39 g/mol. Its IUPAC name is N'-[3-[(3-cyanophenyl)methyl]-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[3-[(3-cyanophenyl)methyl]-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154647984 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N'-[3-[(3-cyanophenyl)methyl]-5-fluoro-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)cc(Cc2cccc(C#N)c2)c1C |
| InChI | InChI=1S/C19H20FN3/c1-4-23(3)13-22-19-11-18(20)10-17(14(19)2)9-15-6-5-7-16(8-15)12-21/h5-8,10-11,13H,4,9H2,1-3H3/b22-13+ |
| InChIKey | UHJYYVSEEBQJAD-LPYMAVHISA-N |
| XLogP | 4.21 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|