C19H20ClN3O — CID 146197821
N'-[2-chloro-4-[(3-cyanophenyl)methyl]-5-methoxyphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197821) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is N'-[2-chloro-4-[(3-cyanophenyl)methyl]-5-methoxyphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[(3-cyanophenyl)methyl]-5-methoxyphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197821 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N'-[2-chloro-4-[(3-cyanophenyl)methyl]-5-methoxyphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(Cc2cccc(C#N)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O/c1-4-23(2)13-22-18-11-19(24-3)16(10-17(18)20)9-14-6-5-7-15(8-14)12-21/h5-8,10-11,13H,4,9H2,1-3H3/b22-13+ |
| InChIKey | PAYPYYCWWQUNDS-LPYMAVHISA-N |
| XLogP | 4.42 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|