C20H23ClN2O3 — CID 155325203
(4-methylphenyl)methyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methoxybenzoate (PubChem CID 155325203) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is (4-methylphenyl)methyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methoxybenzoate.
| Compound Name | (4-methylphenyl)methyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 155325203 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (4-methylphenyl)methyl 5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methoxybenzoate |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(=O)OCc2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O3/c1-5-23(3)13-22-18-11-19(25-4)16(10-17(18)21)20(24)26-12-15-8-6-14(2)7-9-15/h6-11,13H,5,12H2,1-4H3/b22-13+ |
| InChIKey | CDZDLELWKMSRKY-LPYMAVHISA-N |
| XLogP | 4.63 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|