C19H22ClN3O2 — CID 155325266
(5-methyl-2-pyridinyl)methyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate (PubChem CID 155325266) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is (5-methyl-2-pyridinyl)methyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate.
| Compound Name | (5-methyl-2-pyridinyl)methyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
|---|---|
| PubChem CID | 155325266 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (5-methyl-2-pyridinyl)methyl 2-chloro-4-[[ethyl(methyl)amino]methylideneamino]-5-methylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(C(=O)OCc2ccc(C)cn2)cc1C |
| InChI | InChI=1S/C19H22ClN3O2/c1-5-23(4)12-22-18-9-17(20)16(8-14(18)3)19(24)25-11-15-7-6-13(2)10-21-15/h6-10,12H,5,11H2,1-4H3/b22-12+ |
| InChIKey | DWFAFGJWSQHZLL-WSDLNYQXSA-N |
| XLogP | 4.32 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|