C25H27N3O2 — CID 155324959
(4-pyridin-2-ylphenyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate (PubChem CID 155324959) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (4-pyridin-2-ylphenyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate.
| Compound Name | (4-pyridin-2-ylphenyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 155324959 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (4-pyridin-2-ylphenyl)methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCc2ccc(-c3ccccn3)cc2)cc1C |
| InChI | InChI=1S/C25H27N3O2/c1-5-28(4)17-27-24-15-18(2)22(14-19(24)3)25(29)30-16-20-9-11-21(12-10-20)23-8-6-7-13-26-23/h6-15,17H,5,16H2,1-4H3/b27-17+ |
| InChIKey | VSKQOXHTPQESMN-WPWMEQJKSA-N |
| XLogP | 5.33 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|