C20H20F4N2O2 — CID 155325110
[3-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-fluoro-5-methylbenzoate (PubChem CID 155325110) has the molecular formula C20H20F4N2O2 and a molecular weight of 396.38 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-fluoro-5-methylbenzoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-fluoro-5-methylbenzoate |
|---|---|
| PubChem CID | 155325110 |
| Molecular Formula | C20H20F4N2O2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-fluoro-5-methylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(F)c(C(=O)OCc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C20H20F4N2O2/c1-4-26(3)12-25-18-10-17(21)16(8-13(18)2)19(27)28-11-14-6-5-7-15(9-14)20(22,23)24/h5-10,12H,4,11H2,1-3H3/b25-12+ |
| InChIKey | PVUNWRNUTWUMNT-BRJLIKDPSA-N |
| XLogP | 5.12 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|