C21H19F7N2O2 — CID 155324993
[2-fluoro-4-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methyl-5-(trifluoromethyl)benzoate (PubChem CID 155324993) has the molecular formula C21H19F7N2O2 and a molecular weight of 464.38 g/mol. Its IUPAC name is [2-fluoro-4-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methyl-5-(trifluoromethyl)benzoate.
| Compound Name | [2-fluoro-4-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 155324993 |
| Molecular Formula | C21H19F7N2O2 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [2-fluoro-4-(trifluoromethyl)phenyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2-methyl-5-(trifluoromethyl)benzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCc2ccc(C(F)(F)F)cc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H19F7N2O2/c1-4-30(3)11-29-18-7-12(2)15(9-16(18)21(26,27)28)19(31)32-10-13-5-6-14(8-17(13)22)20(23,24)25/h5-9,11H,4,10H2,1-3H3/b29-11+ |
| InChIKey | SVTVUWQJAKMWBJ-VPUKRXIYSA-N |
| XLogP | 6.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|