C14H18F3N3O — CID 163372679
4-[[ethyl(methyl)amino]methylideneamino]-N,2-dimethyl-5-(trifluoromethyl)benzamide (PubChem CID 163372679) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-[[ethyl(methyl)amino]methylideneamino]-N,2-dimethyl-5-(trifluoromethyl)benzamide.
| Compound Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2-dimethyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163372679 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2-dimethyl-5-(trifluoromethyl)benzamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)NC)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O/c1-5-20(4)8-19-12-6-9(2)10(13(21)18-3)7-11(12)14(15,16)17/h6-8H,5H2,1-4H3,(H,18,21)/b19-8+ |
| InChIKey | ZCBZOZBRQWMQLI-UFWORHAWSA-N |
| XLogP | 2.98 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|