C20H22F3N3O2 — CID 155325248
[2-(trifluoromethyl)-4-pyridinyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate (PubChem CID 155325248) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is [2-(trifluoromethyl)-4-pyridinyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate.
| Compound Name | [2-(trifluoromethyl)-4-pyridinyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 155325248 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-(trifluoromethyl)-4-pyridinyl]methyl 4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylbenzoate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)OCc2ccnc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C20H22F3N3O2/c1-5-26(4)12-25-17-9-13(2)16(8-14(17)3)19(27)28-11-15-6-7-24-18(10-15)20(21,22)23/h6-10,12H,5,11H2,1-4H3/b25-12+ |
| InChIKey | KNZLENARHODHFQ-BRJLIKDPSA-N |
| XLogP | 4.69 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|