C16H22F3N3O — CID 163372580
4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 163372580) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 163372580 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[[ethyl(methyl)amino]methylideneamino]-N,2,5-trimethyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(=O)N(C)CC(F)(F)F)cc1C |
| InChI | InChI=1S/C16H22F3N3O/c1-6-21(4)10-20-14-8-11(2)13(7-12(14)3)15(23)22(5)9-16(17,18)19/h7-8,10H,6,9H2,1-5H3/b20-10+ |
| InChIKey | PEHWUFZDMOALRE-KEBDBYFISA-N |
| XLogP | 3.55 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|