C17H25N3O — CID 91295358
N'-[2,5-dimethyl-4-[1-(prop-2-enoxyamino)ethenyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 91295358) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[1-(prop-2-enoxyamino)ethenyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[1-(prop-2-enoxyamino)ethenyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 91295358 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N'-[2,5-dimethyl-4-[1-(prop-2-enoxyamino)ethenyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | C=CCONC(=C)c1cc(C)c(/N=C/N(C)CC)cc1C |
| InChI | InChI=1S/C17H25N3O/c1-7-9-21-19-15(5)16-10-14(4)17(11-13(16)3)18-12-20(6)8-2/h7,10-12,19H,1,5,8-9H2,2-4,6H3/b18-12+ |
| InChIKey | LFLVHJPDFQADIC-LDADJPATSA-N |
| XLogP | 3.59 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|