C20H26FN3OS — CID 129076904
N-ethyl-N'-[4-[[(4-fluorophenyl)sulfanyl-methoxyamino]methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 129076904) has the molecular formula C20H26FN3OS and a molecular weight of 375.51 g/mol. Its IUPAC name is N-ethyl-N'-[4-[[(4-fluorophenyl)sulfanyl-methoxyamino]methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[[(4-fluorophenyl)sulfanyl-methoxyamino]methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129076904 |
| Molecular Formula | C20H26FN3OS |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-ethyl-N'-[4-[[(4-fluorophenyl)sulfanyl-methoxyamino]methyl]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(CN(OC)Sc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C20H26FN3OS/c1-6-23(4)14-22-20-12-15(2)17(11-16(20)3)13-24(25-5)26-19-9-7-18(21)8-10-19/h7-12,14H,6,13H2,1-5H3/b22-14+ |
| InChIKey | XQGUPJWIXMYWJJ-HYARGMPZSA-N |
| XLogP | 5.12 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|