C13H19FN2O — CID 176688125
ethane;N-ethyl-N'-(4-fluoro-2-formylphenyl)-N-methylmethanimidamide (PubChem CID 176688125) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is ethane;N-ethyl-N'-(4-fluoro-2-formylphenyl)-N-methylmethanimidamide.
| Compound Name | ethane;N-ethyl-N'-(4-fluoro-2-formylphenyl)-N-methylmethanimidamide |
|---|---|
| PubChem CID | 176688125 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | ethane;N-ethyl-N'-(4-fluoro-2-formylphenyl)-N-methylmethanimidamide |
| SMILES | CC.CCN(C)/C=N/c1ccc(F)cc1C=O |
| InChI | InChI=1S/C11H13FN2O.C2H6/c1-3-14(2)8-13-11-5-4-10(12)6-9(11)7-15;1-2/h4-8H,3H2,1-2H3;1-2H3/b13-8+; |
| InChIKey | FHJAVAFOVPLCBF-FNXZNAJJSA-N |
| XLogP | 3.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|