C16H15Cl2F2N3 — CID 146197861
N'-[2,5-dichloro-4-(2,4-difluoroanilino)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197861) has the molecular formula C16H15Cl2F2N3 and a molecular weight of 358.22 g/mol. Its IUPAC name is N'-[2,5-dichloro-4-(2,4-difluoroanilino)phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dichloro-4-(2,4-difluoroanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197861 |
| Molecular Formula | C16H15Cl2F2N3 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N'-[2,5-dichloro-4-(2,4-difluoroanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Nc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C16H15Cl2F2N3/c1-3-23(2)9-21-15-7-12(18)16(8-11(15)17)22-14-5-4-10(19)6-13(14)20/h4-9,22H,3H2,1-2H3/b21-9+ |
| InChIKey | JWJIIVZNNMLNPJ-ZVBGSRNCSA-N |
| XLogP | 5.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|