C18H21Cl2N3 — CID 146197650
N'-[2,5-dichloro-4-(2,5-dimethylanilino)phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 146197650) has the molecular formula C18H21Cl2N3 and a molecular weight of 350.29 g/mol. Its IUPAC name is N'-[2,5-dichloro-4-(2,5-dimethylanilino)phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dichloro-4-(2,5-dimethylanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146197650 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N'-[2,5-dichloro-4-(2,5-dimethylanilino)phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Nc2cc(C)ccc2C)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N3/c1-5-23(4)11-21-17-9-15(20)18(10-14(17)19)22-16-8-12(2)6-7-13(16)3/h6-11,22H,5H2,1-4H3/b21-11+ |
| InChIKey | BMURVWFYQQXLKS-SRZZPIQSSA-N |
| XLogP | 5.97 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|