C18H19Cl2N3O2 — CID 146197888
4-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-3-methylbenzoic acid (PubChem CID 146197888) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-3-methylbenzoic acid.
| Compound Name | 4-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 146197888 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-[2,5-dichloro-4-[[ethyl(methyl)amino]methylideneamino]anilino]-3-methylbenzoic acid |
| SMILES | CCN(C)/C=N/c1cc(Cl)c(Nc2ccc(C(=O)O)cc2C)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-4-23(3)10-21-16-8-14(20)17(9-13(16)19)22-15-6-5-12(18(24)25)7-11(15)2/h5-10,22H,4H2,1-3H3,(H,24,25)/b21-10+ |
| InChIKey | RWCOFBIMENRPMO-UFFVCSGVSA-N |
| XLogP | 5.36 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|