C19H28ClN3O3 — CID 167445132
tert-butyl 3-[5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylphenyl]-3-hydroxyazetidine-1-carboxylate (PubChem CID 167445132) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is tert-butyl 3-[5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylphenyl]-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylphenyl]-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 167445132 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | tert-butyl 3-[5-chloro-4-[[ethyl(methyl)amino]methylideneamino]-2-methylphenyl]-3-hydroxyazetidine-1-carboxylate |
| SMILES | CCN(C)/C=N/c1cc(C)c(C2(O)CN(C(=O)OC(C)(C)C)C2)cc1Cl |
| InChI | InChI=1S/C19H28ClN3O3/c1-7-22(6)12-21-16-8-13(2)14(9-15(16)20)19(25)10-23(11-19)17(24)26-18(3,4)5/h8-9,12,25H,7,10-11H2,1-6H3/b21-12+ |
| InChIKey | HGLYGYSZNRLYOF-CIAFOILYSA-N |
| XLogP | 3.70 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|