C13H19NO4S — CID 135331679
tert-butyl 3-hydroxy-3-[3-(hydroxymethyl)thiophen-2-yl]azetidine-1-carboxylate (PubChem CID 135331679) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-[3-(hydroxymethyl)thiophen-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-[3-(hydroxymethyl)thiophen-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 135331679 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl 3-hydroxy-3-[3-(hydroxymethyl)thiophen-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(c2sccc2CO)C1 |
| InChI | InChI=1S/C13H19NO4S/c1-12(2,3)18-11(16)14-7-13(17,8-14)10-9(6-15)4-5-19-10/h4-5,15,17H,6-8H2,1-3H3 |
| InChIKey | BQAJNVXHPOJNHL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |