C17H21NO3S — CID 103696007
tert-butyl 3-(1-benzothiophen-3-ylmethyl)-3-hydroxyazetidine-1-carboxylate (PubChem CID 103696007) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is tert-butyl 3-(1-benzothiophen-3-ylmethyl)-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-benzothiophen-3-ylmethyl)-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 103696007 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl 3-(1-benzothiophen-3-ylmethyl)-3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(Cc2csc3ccccc23)C1 |
| InChI | InChI=1S/C17H21NO3S/c1-16(2,3)21-15(19)18-10-17(20,11-18)8-12-9-22-14-7-5-4-6-13(12)14/h4-7,9,20H,8,10-11H2,1-3H3 |
| InChIKey | PSXUESUHYUHBAK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |