C20H22N2O6S — CID 130295676
(2,5-dioxopyrrolidin-1-yl) 3-(1-benzothiophen-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 130295676) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(1-benzothiophen-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(1-benzothiophen-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 130295676 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(1-benzothiophen-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1csc2ccccc12)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H22N2O6S/c1-20(2,3)27-19(26)21-14(18(25)28-22-16(23)8-9-17(22)24)10-12-11-29-15-7-5-4-6-13(12)15/h4-7,11,14H,8-10H2,1-3H3,(H,21,26) |
| InChIKey | XAXJRJKYKGUTBV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|