C14H18N2O4S2 — CID 68983618
tert-butyl N-(1-benzothiophen-3-ylmethyl)-N-sulfamoylcarbamate (PubChem CID 68983618) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl N-(1-benzothiophen-3-ylmethyl)-N-sulfamoylcarbamate.
| Compound Name | tert-butyl N-(1-benzothiophen-3-ylmethyl)-N-sulfamoylcarbamate |
|---|---|
| PubChem CID | 68983618 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | tert-butyl N-(1-benzothiophen-3-ylmethyl)-N-sulfamoylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1csc2ccccc12)S(N)(=O)=O |
| InChI | InChI=1S/C14H18N2O4S2/c1-14(2,3)20-13(17)16(22(15,18)19)8-10-9-21-12-7-5-4-6-11(10)12/h4-7,9H,8H2,1-3H3,(H2,15,18,19) |
| InChIKey | DLDIYIOOVVFEOU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |