C24H36N2O5S — CID 138469491
tert-butyl 3-amino-4-[1-benzothiophen-3-ylmethyl-[(2R)-1,1-diethoxypropan-2-yl]amino]-4-oxobutanoate (PubChem CID 138469491) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is tert-butyl 3-amino-4-[1-benzothiophen-3-ylmethyl-[(2R)-1,1-diethoxypropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-amino-4-[1-benzothiophen-3-ylmethyl-[(2R)-1,1-diethoxypropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 138469491 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | tert-butyl 3-amino-4-[1-benzothiophen-3-ylmethyl-[(2R)-1,1-diethoxypropan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(OCC)[C@@H](C)N(Cc1csc2ccccc12)C(=O)C(N)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36N2O5S/c1-7-29-23(30-8-2)16(3)26(14-17-15-32-20-12-10-9-11-18(17)20)22(28)19(25)13-21(27)31-24(4,5)6/h9-12,15-16,19,23H,7-8,13-14,25H2,1-6H3/t16-,19?/m1/s1 |
| InChIKey | XUDIZRROXAXTTK-VTBWFHPJSA-N |
| XLogP | 4.08 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|