C34H48N4O7S — CID 87259615
N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanamide (PubChem CID 87259615) has the molecular formula C34H48N4O7S and a molecular weight of 656.85 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanamide |
|---|---|
| PubChem CID | 87259615 |
| Molecular Formula | C34H48N4O7S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanamide |
| SMILES | CCNC(=O)NOCC(=O)NC(Cc1ccc(OC(C)(C)C)cc1)C(=O)N(Cc1csc2ccccc12)C(C)C(OCC)OCC |
| InChI | InChI=1S/C34H48N4O7S/c1-8-35-33(41)37-44-21-30(39)36-28(19-24-15-17-26(18-16-24)45-34(5,6)7)31(40)38(23(4)32(42-9-2)43-10-3)20-25-22-46-29-14-12-11-13-27(25)29/h11-18,22-23,28,32H,8-10,19-21H2,1-7H3,(H,36,39)(H2,35,37,41) |
| InChIKey | DVFWAPJTIOKYPA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|