C25H36N4O8S — CID 87687294
4-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-3-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-4-oxobutanoic acid (PubChem CID 87687294) has the molecular formula C25H36N4O8S and a molecular weight of 552.65 g/mol. Its IUPAC name is 4-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-3-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-3-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87687294 |
| Molecular Formula | C25H36N4O8S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 4-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-3-[[2-(ethylcarbamoylamino)oxyacetyl]amino]-4-oxobutanoic acid |
| SMILES | CCNC(=O)NOCC(=O)NC(CC(=O)O)C(=O)N(Cc1csc2ccccc12)[C@@H](C)C(OCC)OCC |
| InChI | InChI=1S/C25H36N4O8S/c1-5-26-25(34)28-37-14-21(30)27-19(12-22(31)32)23(33)29(16(4)24(35-6-2)36-7-3)13-17-15-38-20-11-9-8-10-18(17)20/h8-11,15-16,19,24H,5-7,12-14H2,1-4H3,(H,27,30)(H,31,32)(H2,26,28,34)/t16-,19?/m0/s1 |
| InChIKey | BJSBOGJVIMJZML-UCFFOFKASA-N |
| XLogP | 2.23 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|