C54H53N3O6S — CID 131730614
9H-fluoren-9-ylmethyl N-[(2S)-1-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate (PubChem CID 131730614) has the molecular formula C54H53N3O6S and a molecular weight of 872.10 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 131730614 |
| Molecular Formula | C54H53N3O6S |
| Molecular Weight | 872.10 g/mol |
| Exact Mass | 871.37 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]carbamate |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1csc2ccccc12)C(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C54H53N3O6S/c1-4-61-52(62-5-2)37(3)57(34-38-36-64-49-32-20-19-27-42(38)49)51(59)48(55-53(60)63-35-47-45-30-17-15-28-43(45)44-29-16-18-31-46(44)47)33-50(58)56-54(39-21-9-6-10-22-39,40-23-11-7-12-24-40)41-25-13-8-14-26-41/h6-32,36-37,47-48,52H,4-5,33-35H2,1-3H3,(H,55,60)(H,56,58)/t37-,48-/m0/s1 |
| InChIKey | RGKQMJPXXZNAAX-PSRXKDJPSA-N |
| XLogP | 10.42 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.10 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|