C55H54N4O6 — CID 67075446
[(2S)-1-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid (PubChem CID 67075446) has the molecular formula C55H54N4O6 and a molecular weight of 867.06 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid.
| Compound Name | [(2S)-1-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 67075446 |
| Molecular Formula | C55H54N4O6 |
| Molecular Weight | 867.06 g/mol |
| Exact Mass | 866.40 |
| IUPAC Name | [(2S)-1-[[(2S)-1,1-diethoxypropan-2-yl]-(quinolin-8-ylmethyl)amino]-1,4-dioxo-4-(tritylamino)butan-2-yl]-(9H-fluoren-9-ylmethyl)carbamic acid |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2cccnc12)C(=O)[C@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)N(CC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C55H54N4O6/c1-4-64-53(65-5-2)38(3)58(36-40-22-19-21-39-23-20-34-56-51(39)40)52(61)49(59(54(62)63)37-48-46-32-17-15-30-44(46)45-31-16-18-33-47(45)48)35-50(60)57-55(41-24-9-6-10-25-41,42-26-11-7-12-27-42)43-28-13-8-14-29-43/h6-34,38,48-49,53H,4-5,35-37H2,1-3H3,(H,57,60)(H,62,63)/t38-,49-/m0/s1 |
| InChIKey | XAFODFSBOPACRP-PDMWITDRSA-N |
| XLogP | 10.01 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.06 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|