C39H51N7O7 — CID 67075030
[6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 67075030) has the molecular formula C39H51N7O7 and a molecular weight of 729.88 g/mol. Its IUPAC name is [6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | [6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67075030 |
| Molecular Formula | C39H51N7O7 |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | [6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2cccnc12)C(=O)C(CCCCNC(=O)O)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C39H51N7O7/c1-5-52-37(53-6-2)27(3)46(25-31-18-12-16-29-19-13-23-40-35(29)31)36(48)33(21-9-10-22-41-39(50)51)43-34(47)26-45(4)44-38(49)42-24-30-17-11-15-28-14-7-8-20-32(28)30/h7-8,11-20,23,27,33,37,41H,5-6,9-10,21-22,24-26H2,1-4H3,(H,43,47)(H,50,51)(H2,42,44,49) |
| InChIKey | QXTUQKRPQNHWIL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 174.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|