C38H48N6O8 — CID 87259694
[(5S)-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-5-[[2-(naphthalen-1-ylmethylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 87259694) has the molecular formula C38H48N6O8 and a molecular weight of 716.84 g/mol. Its IUPAC name is [(5S)-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-5-[[2-(naphthalen-1-ylmethylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | [(5S)-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-5-[[2-(naphthalen-1-ylmethylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 87259694 |
| Molecular Formula | C38H48N6O8 |
| Molecular Weight | 716.84 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | [(5S)-6-[[(2S)-3,3-diethoxy-2-methyl-1-quinolin-8-ylpropyl]amino]-5-[[2-(naphthalen-1-ylmethylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)[C@@H](C)C(NC(=O)[C@H](CCCCNC(=O)O)NC(=O)CONC(=O)NCc1cccc2ccccc12)c1cccc2cccnc12 |
| InChI | InChI=1S/C38H48N6O8/c1-4-50-36(51-5-2)25(3)33(30-19-11-15-27-17-12-22-39-34(27)30)43-35(46)31(20-8-9-21-40-38(48)49)42-32(45)24-52-44-37(47)41-23-28-16-10-14-26-13-6-7-18-29(26)28/h6-7,10-19,22,25,31,33,36,40H,4-5,8-9,20-21,23-24H2,1-3H3,(H,42,45)(H,43,46)(H,48,49)(H2,41,44,47)/t25-,31-,33?/m0/s1 |
| InChIKey | DXLIHDFVBAIDSB-VSGBITGJSA-N |
| XLogP | 4.93 |
| TPSA | 189.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.84 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|