C43H59N7O7 — CID 67088316
tert-butyl-[6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 67088316) has the molecular formula C43H59N7O7 and a molecular weight of 785.99 g/mol. Its IUPAC name is tert-butyl-[6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | tert-butyl-[6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67088316 |
| Molecular Formula | C43H59N7O7 |
| Molecular Weight | 785.99 g/mol |
| Exact Mass | 785.45 |
| IUPAC Name | tert-butyl-[6-[1,1-diethoxypropan-2-yl(quinolin-8-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2cccnc12)C(=O)C(CCCCN(C(=O)O)C(C)(C)C)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C43H59N7O7/c1-8-56-40(57-9-2)30(3)49(28-34-21-15-19-32-22-16-25-44-38(32)34)39(52)36(24-12-13-26-50(42(54)55)43(4,5)6)46-37(51)29-48(7)47-41(53)45-27-33-20-14-18-31-17-10-11-23-35(31)33/h10-11,14-23,25,30,36,40H,8-9,12-13,24,26-29H2,1-7H3,(H,46,51)(H,54,55)(H2,45,47,53) |
| InChIKey | VZIQFHXOJBHNPS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.99 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|