C28H43N5O6 — CID 67075586
N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-methoxy-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 67075586) has the molecular formula C28H43N5O6 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-methoxy-N-(naphthalen-1-ylmethyl)propanamide.
| Compound Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-methoxy-N-(naphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 67075586 |
| Molecular Formula | C28H43N5O6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.32 |
| IUPAC Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-methoxy-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | CCNC(=O)NN(C)CC(=O)NC(COC)C(=O)N(Cc1cccc2ccccc12)C(C)C(OCC)OCC |
| InChI | InChI=1S/C28H43N5O6/c1-7-29-28(36)31-32(5)18-25(34)30-24(19-37-6)26(35)33(20(4)27(38-8-2)39-9-3)17-22-15-12-14-21-13-10-11-16-23(21)22/h10-16,20,24,27H,7-9,17-19H2,1-6H3,(H,30,34)(H2,29,31,36) |
| InChIKey | XNLUFLBTEZKKLB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|