C31H43N5O6 — CID 67075265
N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-(furan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 67075265) has the molecular formula C31H43N5O6 and a molecular weight of 581.71 g/mol. Its IUPAC name is N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-(furan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide.
| Compound Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-(furan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 67075265 |
| Molecular Formula | C31H43N5O6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | N-(1,1-diethoxypropan-2-yl)-2-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-3-(furan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | CCNC(=O)NN(C)CC(=O)NC(Cc1ccco1)C(=O)N(Cc1cccc2ccccc12)C(C)C(OCC)OCC |
| InChI | InChI=1S/C31H43N5O6/c1-6-32-31(39)34-35(5)21-28(37)33-27(19-25-16-12-18-42-25)29(38)36(22(4)30(40-7-2)41-8-3)20-24-15-11-14-23-13-9-10-17-26(23)24/h9-18,22,27,30H,6-8,19-21H2,1-5H3,(H,33,37)(H2,32,34,39) |
| InChIKey | XMBDZGWQBSGXRG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|