C41H53N5O7 — CID 67088247
tert-butyl 4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-3-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-4-oxobutanoate (PubChem CID 67088247) has the molecular formula C41H53N5O7 and a molecular weight of 727.90 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-3-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-3-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 67088247 |
| Molecular Formula | C41H53N5O7 |
| Molecular Weight | 727.90 g/mol |
| Exact Mass | 727.39 |
| IUPAC Name | tert-butyl 4-[[(2S)-1,1-diethoxypropan-2-yl]-(naphthalen-1-ylmethyl)amino]-3-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-4-oxobutanoate |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1cccc2ccccc12)C(=O)C(CC(=O)OC(C)(C)C)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C41H53N5O7/c1-8-51-39(52-9-2)28(3)46(26-32-21-15-19-30-17-11-13-23-34(30)32)38(49)35(24-37(48)53-41(4,5)6)43-36(47)27-45(7)44-40(50)42-25-31-20-14-18-29-16-10-12-22-33(29)31/h10-23,28,35,39H,8-9,24-27H2,1-7H3,(H,43,47)(H2,42,44,50)/t28-,35?/m0/s1 |
| InChIKey | WVSPISRERJSUQX-GYKKGXIBSA-N |
| XLogP | 5.67 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|