C32H42ClN5O5 — CID 67088434
2-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-N-(1,1-diethoxypropan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide (PubChem CID 67088434) has the molecular formula C32H42ClN5O5 and a molecular weight of 612.17 g/mol. Its IUPAC name is 2-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-N-(1,1-diethoxypropan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide.
| Compound Name | 2-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-N-(1,1-diethoxypropan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 67088434 |
| Molecular Formula | C32H42ClN5O5 |
| Molecular Weight | 612.17 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-[[2-[[(4-chlorophenyl)methylcarbamoylamino]-methylamino]acetyl]amino]-N-(1,1-diethoxypropan-2-yl)-N-(naphthalen-1-ylmethyl)propanamide |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(C)NC(=O)CN(C)NC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H42ClN5O5/c1-6-42-31(43-7-2)23(4)38(20-26-13-10-12-25-11-8-9-14-28(25)26)30(40)22(3)35-29(39)21-37(5)36-32(41)34-19-24-15-17-27(33)18-16-24/h8-18,22-23,31H,6-7,19-21H2,1-5H3,(H,35,39)(H2,34,36,41) |
| InChIKey | SYOJFKXAEIFSPF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|