C34H43N5O5S — CID 67088465
N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]propanamide (PubChem CID 67088465) has the molecular formula C34H43N5O5S and a molecular weight of 633.82 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]propanamide.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 67088465 |
| Molecular Formula | C34H43N5O5S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-N-(1,1-diethoxypropan-2-yl)-2-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]propanamide |
| SMILES | CCOC(OCC)C(C)N(Cc1csc2ccccc12)C(=O)C(C)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C34H43N5O5S/c1-6-43-33(44-7-2)24(4)39(20-27-22-45-30-18-11-10-17-29(27)30)32(41)23(3)36-31(40)21-38(5)37-34(42)35-19-26-15-12-14-25-13-8-9-16-28(25)26/h8-18,22-24,33H,6-7,19-21H2,1-5H3,(H,36,40)(H2,35,37,42) |
| InChIKey | AZCRAMCPUQJNNV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|