C44H60N6O7 — CID 67088630
tert-butyl-[6-[1,1-diethoxypropan-2-yl(naphthalen-1-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 67088630) has the molecular formula C44H60N6O7 and a molecular weight of 785.00 g/mol. Its IUPAC name is tert-butyl-[6-[1,1-diethoxypropan-2-yl(naphthalen-1-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | tert-butyl-[6-[1,1-diethoxypropan-2-yl(naphthalen-1-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 67088630 |
| Molecular Formula | C44H60N6O7 |
| Molecular Weight | 785.00 g/mol |
| Exact Mass | 784.45 |
| IUPAC Name | tert-butyl-[6-[1,1-diethoxypropan-2-yl(naphthalen-1-ylmethyl)amino]-5-[[2-[methyl-(naphthalen-1-ylmethylcarbamoylamino)amino]acetyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CCOC(OCC)C(C)N(Cc1cccc2ccccc12)C(=O)C(CCCCN(C(=O)O)C(C)(C)C)NC(=O)CN(C)NC(=O)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C44H60N6O7/c1-8-56-41(57-9-2)31(3)49(29-35-23-17-21-33-19-11-13-25-37(33)35)40(52)38(26-14-15-27-50(43(54)55)44(4,5)6)46-39(51)30-48(7)47-42(53)45-28-34-22-16-20-32-18-10-12-24-36(32)34/h10-13,16-25,31,38,41H,8-9,14-15,26-30H2,1-7H3,(H,46,51)(H,54,55)(H2,45,47,53) |
| InChIKey | AABYPXGBUJYSIK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.00 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|