C33H54N6O7S — CID 67088542
[6-[1-benzothiophen-3-ylmethyl(1,1-diethoxypropan-2-yl)amino]-5-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid (PubChem CID 67088542) has the molecular formula C33H54N6O7S and a molecular weight of 678.90 g/mol. Its IUPAC name is [6-[1-benzothiophen-3-ylmethyl(1,1-diethoxypropan-2-yl)amino]-5-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid.
| Compound Name | [6-[1-benzothiophen-3-ylmethyl(1,1-diethoxypropan-2-yl)amino]-5-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67088542 |
| Molecular Formula | C33H54N6O7S |
| Molecular Weight | 678.90 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | [6-[1-benzothiophen-3-ylmethyl(1,1-diethoxypropan-2-yl)amino]-5-[[2-[(ethylcarbamoylamino)-methylamino]acetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid |
| SMILES | CCNC(=O)NN(C)CC(=O)NC(CCCCN(C(=O)O)C(C)(C)C)C(=O)N(Cc1csc2ccccc12)C(C)C(OCC)OCC |
| InChI | InChI=1S/C33H54N6O7S/c1-9-34-31(42)36-37(8)21-28(40)35-26(17-14-15-19-39(32(43)44)33(5,6)7)29(41)38(23(4)30(45-10-2)46-11-3)20-24-22-47-27-18-13-12-16-25(24)27/h12-13,16,18,22-23,26,30H,9-11,14-15,17,19-21H2,1-8H3,(H,35,40)(H,43,44)(H2,34,36,42) |
| InChIKey | MQZPGJBUYUZPEI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|