C37H53N5O8S — CID 87263410
[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-[[2-(benzylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid (PubChem CID 87263410) has the molecular formula C37H53N5O8S and a molecular weight of 727.93 g/mol. Its IUPAC name is [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-[[2-(benzylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid.
| Compound Name | [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-[[2-(benzylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87263410 |
| Molecular Formula | C37H53N5O8S |
| Molecular Weight | 727.93 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | [(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-[[2-(benzylcarbamoylamino)oxyacetyl]amino]-6-oxohexyl]-tert-butylcarbamic acid |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1csc2ccccc12)C(=O)[C@H](CCCCN(C(=O)O)C(C)(C)C)NC(=O)CONC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C37H53N5O8S/c1-7-48-34(49-8-2)26(3)41(23-28-25-51-31-20-13-12-18-29(28)31)33(44)30(19-14-15-21-42(36(46)47)37(4,5)6)39-32(43)24-50-40-35(45)38-22-27-16-10-9-11-17-27/h9-13,16-18,20,25-26,30,34H,7-8,14-15,19,21-24H2,1-6H3,(H,39,43)(H,46,47)(H2,38,40,45)/t26-,30-/m0/s1 |
| InChIKey | ARMYFHUSUPNHPF-YZNIXAGQSA-N |
| XLogP | 5.88 |
| TPSA | 158.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.93 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|