C41H53N3O5S — CID 67088457
tert-butyl N-[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-(9H-fluoren-9-ylmethylamino)-6-oxohexyl]carbamate (PubChem CID 67088457) has the molecular formula C41H53N3O5S and a molecular weight of 699.96 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-(9H-fluoren-9-ylmethylamino)-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-(9H-fluoren-9-ylmethylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 67088457 |
| Molecular Formula | C41H53N3O5S |
| Molecular Weight | 699.96 g/mol |
| Exact Mass | 699.37 |
| IUPAC Name | tert-butyl N-[(5S)-6-[1-benzothiophen-3-ylmethyl-[(2S)-1,1-diethoxypropan-2-yl]amino]-5-(9H-fluoren-9-ylmethylamino)-6-oxohexyl]carbamate |
| SMILES | CCOC(OCC)[C@H](C)N(Cc1csc2ccccc12)C(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H53N3O5S/c1-7-47-39(48-8-2)28(3)44(26-29-27-50-37-23-14-13-17-30(29)37)38(45)36(22-15-16-24-42-40(46)49-41(4,5)6)43-25-35-33-20-11-9-18-31(33)32-19-10-12-21-34(32)35/h9-14,17-21,23,27-28,35-36,39,43H,7-8,15-16,22,24-26H2,1-6H3,(H,42,46)/t28-,36-/m0/s1 |
| InChIKey | MWSYUEBROBOHOE-GOOPYHEFSA-N |
| XLogP | 8.48 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.96 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|