C36H41N3O5S2 — CID 67706548
tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 67706548) has the molecular formula C36H41N3O5S2 and a molecular weight of 659.87 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 67706548 |
| Molecular Formula | C36H41N3O5S2 |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-6-(9H-fluoren-9-ylmethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C36H41N3O5S2/c1-36(2,3)44-35(42)38-32(33(40)39(22-25-12-10-20-45-25)23-26-13-11-21-46-26)18-8-9-19-37-34(41)43-24-31-29-16-6-4-14-27(29)28-15-5-7-17-30(28)31/h4-7,10-17,20-21,31-32H,8-9,18-19,22-24H2,1-3H3,(H,37,41)(H,38,42)/t32-/m0/s1 |
| InChIKey | KEQKJYIQFRTNTL-YTTGMZPUSA-N |
| XLogP | 7.94 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|