C25H33N3O5S4 — CID 140616755
tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(thiophen-2-ylsulfonylamino)hexan-2-yl]carbamate (PubChem CID 140616755) has the molecular formula C25H33N3O5S4 and a molecular weight of 583.82 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(thiophen-2-ylsulfonylamino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(thiophen-2-ylsulfonylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 140616755 |
| Molecular Formula | C25H33N3O5S4 |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-[bis(thiophen-2-ylmethyl)amino]-1-oxo-6-(thiophen-2-ylsulfonylamino)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNS(=O)(=O)c1cccs1)C(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C25H33N3O5S4/c1-25(2,3)33-24(30)27-21(11-4-5-13-26-37(31,32)22-12-8-16-36-22)23(29)28(17-19-9-6-14-34-19)18-20-10-7-15-35-20/h6-10,12,14-16,21,26H,4-5,11,13,17-18H2,1-3H3,(H,27,30)/t21-/m0/s1 |
| InChIKey | BFAYOLYIUUTHBK-NRFANRHFSA-N |
| XLogP | 5.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|